![[ICO]](/icons/blank.gif){kind=icon}
|
Name | Last modified | Size | Description |
|---|---|---|---|---|
|
Parent Directory | - | ||
|
2 Loops Lautrec | 20-Apr-2018 16:20 | - | |
|
2nd Nature | 20-Apr-2018 16:20 | - | |
|
5 Years and Counting | 20-Apr-2018 16:20 | - | |
|
A.Human | 20-Apr-2018 16:20 | - | |
|
Abdel Karim Ensemble | 20-Apr-2018 16:20 | - | |
|
Absconded | 20-Apr-2018 16:20 | - | |
|
Abysal | 20-Apr-2018 16:20 | - | |
|
Acapulco Radio | 20-Apr-2018 16:20 | - | |
|
Al-Yaman | 20-Apr-2018 16:20 | - | |
|
Albert Road | 20-Apr-2018 16:20 | - | |
|
Alexandre Grooves | 20-Apr-2018 16:20 | - | |
|
Ancient Of Days | 20-Apr-2018 16:20 | - | |
|
Anormal Youth | 20-Apr-2018 16:20 | - | |
|
Antti & Jarno | 20-Apr-2018 16:20 | - | |
|
Arte Nut | 20-Apr-2018 16:20 | - | |
|
Ashtar Afterhours | 20-Apr-2018 16:20 | - | |
|
Avotor | 20-Apr-2018 16:20 | - | |
|
BOP (Harvey) | 20-Apr-2018 16:20 | - | |
|
Bassline Generation | 20-Apr-2018 16:20 | - | |
|
Bat Makumba | 20-Apr-2018 16:20 | - | |
|
Betsy Grant | 20-Apr-2018 16:20 | - | |
|
Bill Evans, Bobby Hutcherson, Karin Krog & Archie Shepp | 20-Apr-2018 16:20 | - | |
|
Black Belt Jones | 20-Apr-2018 16:20 | - | |
|
Born Heller | 20-Apr-2018 16:20 | - | |
|
Brad Shepik | 20-Apr-2018 16:20 | - | |
|
Buckfast | 20-Apr-2018 16:20 | - | |
|
CO-AX | 20-Apr-2018 16:20 | - | |
|
Cannival Method | 20-Apr-2018 16:20 | - | |
|
Carl Zimmer | 20-Apr-2018 16:20 | - | |
|
Catherine Deneuve & Serge Gainsbourg | 20-Apr-2018 16:20 | - | |
|
Cherry Coke | 20-Apr-2018 16:20 | - | |
|
China Burton | 20-Apr-2018 16:20 | - | |
|
Chris Sorbello | 20-Apr-2018 16:20 | - | |
|
Claude Blouin | 20-Apr-2018 16:20 | - | |
|
Cloning Americana | 20-Apr-2018 16:20 | - | |
|
Club Futura | 20-Apr-2018 16:20 | - | |
|
Concepción Glory Boys | 20-Apr-2018 16:20 | - | |
|
Confessor | 20-Apr-2018 16:20 | - | |
|
Corlea Botha | 20-Apr-2018 16:20 | - | |
|
Coyoli | 20-Apr-2018 16:20 | - | |
|
Cruelty Campaign | 20-Apr-2018 16:20 | - | |
|
Cyclone Б | 20-Apr-2018 16:20 | - | |
|
DJ DBC | 20-Apr-2018 16:20 | - | |
|
Daniel Hecht | 20-Apr-2018 16:20 | - | |
|
Danielson Famile | 20-Apr-2018 16:20 | - | |
|
Dark Land | 20-Apr-2018 16:20 | - | |
|
David Bach | 20-Apr-2018 16:20 | - | |
|
Deadface | 20-Apr-2018 16:20 | - | |
|
Dee | 20-Apr-2018 16:20 | - | |
|
Delacroix | 20-Apr-2018 16:20 | - | |
|
Delta Blues Band | 20-Apr-2018 16:20 | - | |
|
Destination X | 20-Apr-2018 16:20 | - | |
|
Diagram of The Heart | 20-Apr-2018 16:20 | - | |
|
Digital Masters | 20-Apr-2018 16:20 | - | |
|
Diomedes Dionisio Díaz | 20-Apr-2018 16:20 | - | |
|
Disaffected | 20-Apr-2018 16:20 | - | |
|
Divine Source | 20-Apr-2018 16:20 | - | |
|
Doctor Nerve & Sirius String Quartet | 20-Apr-2018 16:20 | - | |
|
Don S | 20-Apr-2018 16:20 | - | |
|
Edvīns Krūmiņš | 20-Apr-2018 16:20 | - | |
|
El Festival de los Viajes | 20-Apr-2018 16:20 | - | |
|
Elton | 20-Apr-2018 16:20 | - | |
|
Emo Summer | 20-Apr-2018 16:20 | - | |
|
Evan Parker, Keith Rowe, Barry Guy & Eddie Prévost | 20-Apr-2018 16:20 | - | |
|
Facção Central | 20-Apr-2018 16:20 | - | |
|
Francisco Furtado | 20-Apr-2018 16:20 | - | |
|
Frater Sinister | 20-Apr-2018 16:20 | - | |
|
Freddie Keppard | 20-Apr-2018 16:20 | - | |
|
Friend Of A Friend | 20-Apr-2018 16:20 | - | |
|
Furianga | 20-Apr-2018 16:20 | - | |
|
Genialistid | 20-Apr-2018 16:20 | - | |
|
Genious Oven | 20-Apr-2018 16:20 | - | |
|
Gigantic | 20-Apr-2018 16:20 | - | |
|
Give It Life | 20-Apr-2018 16:20 | - | |
|
Greg Dulli & Mark Lanegan | 20-Apr-2018 16:20 | - | |
|
Guante & See More Perspective | 20-Apr-2018 16:20 | - | |
|
H-Man | 20-Apr-2018 16:20 | - | |
|
Hallelujah | 20-Apr-2018 16:20 | - | |
|
Hallo | 20-Apr-2018 16:20 | - | |
|
Harry Stenfors | 20-Apr-2018 16:20 | - | |
|
Heather Eatman | 20-Apr-2018 16:20 | - | |
|
Heavens Dance | 20-Apr-2018 16:20 | - | |
|
Helcaraxë | 20-Apr-2018 16:20 | - | |
|
Hermann Hudde | 20-Apr-2018 16:20 | - | |
|
Hindugrass | 20-Apr-2018 16:20 | - | |
|
Hope Daniels | 20-Apr-2018 16:20 | - | |
|
Houseland | 20-Apr-2018 16:20 | - | |
|
Huckleberry | 20-Apr-2018 16:20 | - | |
|
Hush | 20-Apr-2018 16:20 | - | |
|
Immigrant | 20-Apr-2018 16:20 | - | |
|
In Company of Spiders | 20-Apr-2018 16:20 | - | |
|
Institut | 20-Apr-2018 16:20 | - | |
|
Ithaka Maria | 20-Apr-2018 16:20 | - | |
|
Jack N. House | 20-Apr-2018 16:20 | - | |
|
Jacob Latham | 20-Apr-2018 16:20 | - | |
|
Jah Wobble, Jaki Liebezeit & Philip Jeck | 20-Apr-2018 16:20 | - | |
|
James McGillivray | 20-Apr-2018 16:20 | - | |
|
Jan Garbarek & Kjell Johnsen | 20-Apr-2018 16:20 | - | |
|
Jivaro | 20-Apr-2018 16:20 | - | |
|
John M. Cummuta | 20-Apr-2018 16:20 | - | |
|
John Paul Sharp | 20-Apr-2018 16:20 | - | |
|
Journey to Ixtlan | 20-Apr-2018 16:20 | - | |
|
KAREN | 20-Apr-2018 16:20 | - | |
|
Kait Tamra & Indrek Kalda | 20-Apr-2018 16:20 | - | |
|
Kalvik | 20-Apr-2018 16:20 | - | |
|
Kamphundar | 20-Apr-2018 16:20 | - | |
|
Kantor Voy | 20-Apr-2018 16:20 | - | |
|
Kava | 20-Apr-2018 16:20 | - | |
|
Kevin Moore | 20-Apr-2018 16:20 | - | |
|
Kid Million | 20-Apr-2018 16:20 | - | |
|
Kitty Badass | 20-Apr-2018 16:20 | - | |
|
La Sombra | 20-Apr-2018 16:20 | - | |
|
Le Grand Orchestre Afro-Cubain de Paris | 20-Apr-2018 16:20 | - | |
|
Leonard Cohen, Dave Cousins & The Strawbs | 20-Apr-2018 16:20 | - | |
|
Lil' Johnny | 20-Apr-2018 16:20 | - | |
|
Linda Hopkins | 20-Apr-2018 16:20 | - | |
|
Liz Brunelle | 20-Apr-2018 16:20 | - | |
|
Long Way Down | 20-Apr-2018 16:20 | - | |
|
Los H.H. | 20-Apr-2018 16:20 | - | |
|
Lovebug Starski & Harlem World Crew | 20-Apr-2018 16:20 | - | |
|
Lucio Maia | 20-Apr-2018 16:20 | - | |
|
Lysergene | 20-Apr-2018 16:20 | - | |
|
MM | 20-Apr-2018 16:20 | - | |
|
Malcolm Scarpa, Ñaco Goñi y los Jokers | 20-Apr-2018 16:20 | - | |
|
Mantic | 20-Apr-2018 16:20 | - | |
|
Mantis | 20-Apr-2018 16:20 | - | |
|
Mar | 20-Apr-2018 16:20 | - | |
|
Massimo Priviero & Michele Gazich | 20-Apr-2018 16:20 | - | |
|
Meatlocker Seven | 20-Apr-2018 16:20 | - | |
|
Micropupazzo | 20-Apr-2018 16:20 | - | |
|
Miguel Graça | 20-Apr-2018 16:20 | - | |
|
Milan Knížák | 20-Apr-2018 16:20 | - | |
|
Mima | 20-Apr-2018 16:20 | - | |
|
Mind Riot | 20-Apr-2018 16:20 | - | |
|
Mission Of Light | 20-Apr-2018 16:20 | - | |
|
Mojémismagdalenasentusangre | 20-Apr-2018 16:20 | - | |
|
Money Aujla | 20-Apr-2018 16:20 | - | |
|
Monotremata | 20-Apr-2018 16:20 | - | |
|
Monsters of the Midday | 20-Apr-2018 16:20 | - | |
|
Montana Mandolin Society | 20-Apr-2018 16:20 | - | |
|
Morzhol | 20-Apr-2018 16:20 | - | |
|
Mothers Pride | 20-Apr-2018 16:20 | - | |
|
Mumbo-Jumbo | 20-Apr-2018 16:20 | - | |
|
Necroptic | 20-Apr-2018 16:20 | - | |
|
Negramaro | 20-Apr-2018 16:20 | - | |
|
Neurotic | 20-Apr-2018 16:20 | - | |
|
NeverSayDie | 20-Apr-2018 16:20 | - | |
|
Nikos Veliotis & Anastasis Grivas | 20-Apr-2018 16:20 | - | |
|
Noah D | 20-Apr-2018 16:20 | - | |
|
Noel Williams | 20-Apr-2018 16:20 | - | |
|
Nylon Union | 20-Apr-2018 16:20 | - | |
|
OQuadro | 20-Apr-2018 16:20 | - | |
|
Orange Jews | 20-Apr-2018 16:20 | - | |
|
Outrun The Gun | 20-Apr-2018 16:20 | - | |
|
Paha Polly | 20-Apr-2018 16:20 | - | |
|
Pandamosity | 20-Apr-2018 16:20 | - | |
|
Pandetrave | 20-Apr-2018 16:20 | - | |
|
Paolo Belli & Marcosbanda | 20-Apr-2018 16:20 | - | |
|
Paolo Jannacci | 20-Apr-2018 16:20 | - | |
|
Pete Weiss & the Rock Band | 20-Apr-2018 16:20 | - | |
|
Phon°noir | 20-Apr-2018 16:20 | - | |
|
Pixote | 20-Apr-2018 16:20 | - | |
|
Polluted Axis | 20-Apr-2018 16:20 | - | |
|
Poppy No Good and the Phantom Band | 20-Apr-2018 16:20 | - | |
|
Pressure Flip | 20-Apr-2018 16:20 | - | |
|
Prizefighter | 20-Apr-2018 16:20 | - | |
|
Professor Grant Hardy | 20-Apr-2018 16:20 | - | |
|
Promises | 20-Apr-2018 16:20 | - | |
|
PsychotekTrauma | 20-Apr-2018 16:20 | - | |
|
Real Space Noise | 20-Apr-2018 16:20 | - | |
|
Regeneration | 20-Apr-2018 16:20 | - | |
|
Retarted Elf | 20-Apr-2018 16:20 | - | |
|
Rhadamantys | 20-Apr-2018 16:20 | - | |
|
Richard Wood | 20-Apr-2018 16:20 | - | |
|
Rijk de Gooyer | 20-Apr-2018 16:20 | - | |
|
Rock`G´Socks | 20-Apr-2018 16:20 | - | |
|
Rocky Núñez | 20-Apr-2018 16:20 | - | |
|
Roger Espinoza | 20-Apr-2018 16:20 | - | |
|
Rosita & Club 68 | 20-Apr-2018 16:20 | - | |
|
Rushya | 20-Apr-2018 16:20 | - | |
|
Rüdiger Carl & Sven-Åke Johansson | 20-Apr-2018 16:20 | - | |
|
Santo Barrio | 20-Apr-2018 16:20 | - | |
|
Scotia Nostra | 20-Apr-2018 16:20 | - | |
|
Selva | 20-Apr-2018 16:20 | - | |
|
Serpent Teeth | 20-Apr-2018 16:20 | - | |
|
Shantanu Kundu | 20-Apr-2018 16:20 | - | |
|
Shea Norman | 20-Apr-2018 16:20 | - | |
|
Shieldwall | 20-Apr-2018 16:20 | - | |
|
South Catherine St. Jug Band | 20-Apr-2018 16:20 | - | |
|
Starvue | 20-Apr-2018 16:20 | - | |
|
Sten Ove Toft | 20-Apr-2018 16:20 | - | |
|
Stereolove | 20-Apr-2018 16:20 | - | |
|
Steven Halpern & Suru | 20-Apr-2018 16:20 | - | |
|
Stewart & Winfield | 20-Apr-2018 16:20 | - | |
|
Style | 20-Apr-2018 16:20 | - | |
|
Sub Figura | 20-Apr-2018 16:20 | - | |
|
Sub Swara | 20-Apr-2018 16:20 | - | |
|
Sunken | 20-Apr-2018 16:20 | - | |
|
Szalóki Ági | 20-Apr-2018 16:20 | - | |
|
Teemu Elon Puhuvat Eläimet | 20-Apr-2018 16:20 | - | |
|
Tepr | 20-Apr-2018 16:20 | - | |
|
Tesuji | 20-Apr-2018 16:20 | - | |
|
The Ancient War | 20-Apr-2018 16:20 | - | |
|
The Bluegrass Drifters | 20-Apr-2018 16:20 | - | |
|
The Break In | 20-Apr-2018 16:20 | - | |
|
The Corrections | 20-Apr-2018 16:20 | - | |
|
The Dead Body Men | 20-Apr-2018 16:20 | - | |
|
The Demigodz | 20-Apr-2018 16:20 | - | |
|
The Dual Dragons | 20-Apr-2018 16:20 | - | |
|
The Embassadors | 20-Apr-2018 16:20 | - | |
|
The Hogs | 20-Apr-2018 16:20 | - | |
|
The Lull Between | 20-Apr-2018 16:20 | - | |
|
The Neatbeats | 20-Apr-2018 16:20 | - | |
|
The Red Hot Valentines | 20-Apr-2018 16:20 | - | |
|
The Static Silence | 20-Apr-2018 16:20 | - | |
|
The Tah-dahs | 20-Apr-2018 16:20 | - | |
|
The Workout | 20-Apr-2018 16:20 | - | |
|
The Yalloppin' Hounds | 20-Apr-2018 16:20 | - | |
|
Tijuana | 20-Apr-2018 16:20 | - | |
|
Toadsuck Symphony | 20-Apr-2018 16:20 | - | |
|
Trabulence | 20-Apr-2018 16:20 | - | |
|
Troja Jazzband | 20-Apr-2018 16:20 | - | |
|
Tropical Dudes | 20-Apr-2018 16:20 | - | |
|
Tõnis Mägi + Politseiorkester | 20-Apr-2018 16:20 | - | |
|
V čechách děti Boha znají | 20-Apr-2018 16:20 | - | |
|
Vanraj Bhatia | 20-Apr-2018 16:20 | - | |
|
Various & Scant Intone | 20-Apr-2018 16:20 | - | |
|
Vincent Atmicus | 20-Apr-2018 16:20 | - | |
|
Virginia Rea | 20-Apr-2018 16:20 | - | |
|
Vizir | 20-Apr-2018 16:20 | - | |
|
Wandering Star | 20-Apr-2018 16:20 | - | |
|
Watch the Sky | 20-Apr-2018 16:20 | - | |
|
Wayne Bedrosian | 20-Apr-2018 16:20 | - | |
|
WeltenBrand | 20-Apr-2018 16:20 | - | |
|
Wild Colonial Bhoys | 20-Apr-2018 16:20 | - | |
|
Wintercult | 20-Apr-2018 16:20 | - | |
|
YahZarah | 20-Apr-2018 16:20 | - | |
|
Yandé Codou Sène | 20-Apr-2018 16:20 | - | |
|
Yellow Magic Orchestra & The Human League | 20-Apr-2018 16:20 | - | |
|
Zaap | 20-Apr-2018 16:20 | - | |
|
cigarRATS | 20-Apr-2018 16:20 | - | |
|
mihimaru GT with SOFFet | 20-Apr-2018 16:20 | - | |
|
ÍKORNI | 20-Apr-2018 16:20 | - | |
|
Χρόνης Αηδονίδης | 20-Apr-2018 16:20 | - | |
|
Вадим Курылёв - Электрические партизаны | 20-Apr-2018 16:20 | - | |
|
Новая модель | 20-Apr-2018 16:20 | - | |
|
Профессор Лебединский и Русский Размер | 20-Apr-2018 16:20 | - | |
|
ゆの (阿澄佳奈)、宮子 (水橋かおり)、ヒロ (後藤邑子)、沙英 (新谷良子) | 20-Apr-2018 16:20 | - | |
|
友川カズキ | 20-Apr-2018 16:20 | - | |
|
殿さまキングス | 20-Apr-2018 16:20 | - | |